C32H37NO8S — CID 11786692
[(3R,5S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11786692) has the molecular formula C32H37NO8S and a molecular weight of 595.71 g/mol. Its IUPAC name is [(3R,5S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R,5S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11786692 |
| Molecular Formula | C32H37NO8S |
| Molecular Weight | 595.71 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | [(3R,5S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-benzyl-1,2-oxazolidin-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@H]([C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]3OCc3ccccc3)N(Cc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C32H37NO8S/c1-22-14-16-26(17-15-22)42(34,35)37-21-25-18-27(33(41-25)19-23-10-6-4-7-11-23)28-29(36-20-24-12-8-5-9-13-24)30-31(38-28)40-32(2,3)39-30/h4-17,25,27-31H,18-21H2,1-3H3/t25-,27+,28+,29-,30+,31+/m0/s1 |
| InChIKey | JLRLYJZJPJQEGB-KZEJMWBGSA-N |
| XLogP | 4.74 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|