C25H28N2O — CID 102428244
2-[4-(2,5-ditert-butyl-4-methoxyphenyl)cyclohepta-2,4,6-trien-1-ylidene]propanedinitrile (PubChem CID 102428244) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[4-(2,5-ditert-butyl-4-methoxyphenyl)cyclohepta-2,4,6-trien-1-ylidene]propanedinitrile.
| Compound Name | 2-[4-(2,5-ditert-butyl-4-methoxyphenyl)cyclohepta-2,4,6-trien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102428244 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-[4-(2,5-ditert-butyl-4-methoxyphenyl)cyclohepta-2,4,6-trien-1-ylidene]propanedinitrile |
| SMILES | COc1cc(C(C)(C)C)c(C2=CC=CC(=C(C#N)C#N)C=C2)cc1C(C)(C)C |
| InChI | InChI=1S/C25H28N2O/c1-24(2,3)21-14-23(28-7)22(25(4,5)6)13-20(21)18-10-8-9-17(11-12-18)19(15-26)16-27/h8-14H,1-7H3 |
| InChIKey | WEDJNCKLOCSUSY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|