About 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane
1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane (PubChem CID 102429166) has the molecular formula C25H26NPS2Se
and a molecular weight of 514.56 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane |
| PubChem CID | 102429166 |
| Molecular Formula | C25H26NPS2Se |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane |
| SMILES | CC(CP(=[Se])(CC(C)c1ccccc1)Sc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C25H26NPS2Se/c1-19(21-11-5-3-6-12-21)17-27(30,18-20(2)22-13-7-4-8-14-22)29-25-26-23-15-9-10-16-24(23)28-25/h3-16,19-20H,17-18H2,1-2H3 |
| InChIKey | VXZGDJZRLKDKJU-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane?
The IUPAC name of 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane (CID 102429166) is 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane.
What is the SMILES notation for 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane?
The canonical SMILES for 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane is CC(CP(=[Se])(CC(C)c1ccccc1)Sc1nc2ccccc2s1)c1ccccc1.
What is the InChIKey of 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane?
The InChIKey is VXZGDJZRLKDKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26NPS2Se/c1-19(21-11-5-3-6-12-21)17-27(30,18-20(2)22-13-7-4-8-14-22)29-25-26-23-15-9-10-16-24(23)28-25/h3-16,19-20H,17-18H2,1-2H3.
What are the key properties of 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane?
1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane has a molecular weight of 514.56 g/mol, XLogP of 8.01, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane is sourced from PubChem (CID 102429166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).