C25H26NPS2Se — CID 102429166
1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane (PubChem CID 102429166) has the molecular formula C25H26NPS2Se and a molecular weight of 514.56 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane.
| Compound Name | 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 102429166 |
| Molecular Formula | C25H26NPS2Se |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | 1,3-benzothiazol-2-ylsulfanyl-bis(2-phenylpropyl)-selanylidene-λ5-phosphane |
| SMILES | CC(CP(=[Se])(CC(C)c1ccccc1)Sc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C25H26NPS2Se/c1-19(21-11-5-3-6-12-21)17-27(30,18-20(2)22-13-7-4-8-14-22)29-25-26-23-15-9-10-16-24(23)28-25/h3-16,19-20H,17-18H2,1-2H3 |
| InChIKey | VXZGDJZRLKDKJU-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|