C16H25N2O+ — CID 102429803
1,3-dicyclohexylimidazol-1-ium-2-carbaldehyde (PubChem CID 102429803) has the molecular formula C16H25N2O+ and a molecular weight of 261.39 g/mol. Its IUPAC name is 1,3-dicyclohexylimidazol-1-ium-2-carbaldehyde.
| Compound Name | 1,3-dicyclohexylimidazol-1-ium-2-carbaldehyde |
|---|---|
| PubChem CID | 102429803 |
| Molecular Formula | C16H25N2O+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 1,3-dicyclohexylimidazol-1-ium-2-carbaldehyde |
| SMILES | O=Cc1n(C2CCCCC2)cc[n+]1C1CCCCC1 |
| InChI | InChI=1S/C16H25N2O/c19-13-16-17(14-7-3-1-4-8-14)11-12-18(16)15-9-5-2-6-10-15/h11-15H,1-10H2/q+1 |
| InChIKey | ZHKMWBAITIAXBT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|