C22H36ClN3O4 — CID 139232827
N-cyclohexyl-1-(1,3-dicyclohexylimidazol-1-ium-2-yl)methanimine perchlorate (PubChem CID 139232827) has the molecular formula C22H36ClN3O4 and a molecular weight of 442.00 g/mol. Its IUPAC name is N-cyclohexyl-1-(1,3-dicyclohexylimidazol-1-ium-2-yl)methanimine perchlorate.
| Compound Name | N-cyclohexyl-1-(1,3-dicyclohexylimidazol-1-ium-2-yl)methanimine perchlorate |
|---|---|
| PubChem CID | 139232827 |
| Molecular Formula | C22H36ClN3O4 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-cyclohexyl-1-(1,3-dicyclohexylimidazol-1-ium-2-yl)methanimine perchlorate |
| SMILES | C(=N/C1CCCCC1)\c1n(C2CCCCC2)cc[n+]1C1CCCCC1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H36N3.ClHO4/c1-4-10-19(11-5-1)23-18-22-24(20-12-6-2-7-13-20)16-17-25(22)21-14-8-3-9-15-21;2-1(3,4)5/h16-21H,1-15H2;(H,2,3,4,5)/q+1;/p-1/b23-18+; |
| InChIKey | GBAYJFQECRLOSI-XHMOQMQQSA-M |
| XLogP | 0.78 |
| TPSA | 113.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|