C16H24N2OS — CID 56931458
1,3-dicyclohexylimidazol-1-ium-2-carbothioate (PubChem CID 56931458) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 1,3-dicyclohexylimidazol-1-ium-2-carbothioate.
| Compound Name | 1,3-dicyclohexylimidazol-1-ium-2-carbothioate |
|---|---|
| PubChem CID | 56931458 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1,3-dicyclohexylimidazol-1-ium-2-carbothioate |
| SMILES | O=C([S-])c1n(C2CCCCC2)cc[n+]1C1CCCCC1 |
| InChI | InChI=1S/C16H24N2OS/c19-16(20)15-17(13-7-3-1-4-8-13)11-12-18(15)14-9-5-2-6-10-14/h11-14H,1-10H2 |
| InChIKey | DCQWBDITSMDFQG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|