C17H11Cl2N3O2 — CID 102431383
N-(4,6-dichloropyrimidin-5-yl)-N-(4-phenoxyphenyl)formamide (PubChem CID 102431383) has the molecular formula C17H11Cl2N3O2 and a molecular weight of 360.20 g/mol. Its IUPAC name is N-(4,6-dichloropyrimidin-5-yl)-N-(4-phenoxyphenyl)formamide.
| Compound Name | N-(4,6-dichloropyrimidin-5-yl)-N-(4-phenoxyphenyl)formamide |
|---|---|
| PubChem CID | 102431383 |
| Molecular Formula | C17H11Cl2N3O2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-(4,6-dichloropyrimidin-5-yl)-N-(4-phenoxyphenyl)formamide |
| SMILES | O=CN(c1ccc(Oc2ccccc2)cc1)c1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C17H11Cl2N3O2/c18-16-15(17(19)21-10-20-16)22(11-23)12-6-8-14(9-7-12)24-13-4-2-1-3-5-13/h1-11H |
| InChIKey | NVJWXHAFCGYYLS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|