C23H17ClN2O3 — CID 53432907
N-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenoxyphenyl)formamide (PubChem CID 53432907) has the molecular formula C23H17ClN2O3 and a molecular weight of 404.85 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenoxyphenyl)formamide.
| Compound Name | N-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenoxyphenyl)formamide |
|---|---|
| PubChem CID | 53432907 |
| Molecular Formula | C23H17ClN2O3 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-(4-phenoxyphenyl)formamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1N(C=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H17ClN2O3/c1-16-23(22(25-29-16)20-9-5-6-10-21(20)24)26(15-27)17-11-13-19(14-12-17)28-18-7-3-2-4-8-18/h2-15H,1H3 |
| InChIKey | HEMJWEOHQXPMOX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|