C21H21Cl2N3O2 — CID 53432875
N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[4-(diethylamino)phenyl]formamide (PubChem CID 53432875) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[4-(diethylamino)phenyl]formamide.
| Compound Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[4-(diethylamino)phenyl]formamide |
|---|---|
| PubChem CID | 53432875 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[4-(diethylamino)phenyl]formamide |
| SMILES | CCN(CC)c1ccc(N(C=O)c2c(-c3c(Cl)cccc3Cl)noc2C)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-4-25(5-2)15-9-11-16(12-10-15)26(13-27)21-14(3)28-24-20(21)19-17(22)7-6-8-18(19)23/h6-13H,4-5H2,1-3H3 |
| InChIKey | DIMTXWALIRASFW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|