C23H24Cl2N4O2 — CID 22302926
1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[(Z)-(2,3,4,5,6-pentamethylphenyl)methylideneamino]urea (PubChem CID 22302926) has the molecular formula C23H24Cl2N4O2 and a molecular weight of 459.38 g/mol. Its IUPAC name is 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[(Z)-(2,3,4,5,6-pentamethylphenyl)methylideneamino]urea.
| Compound Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[(Z)-(2,3,4,5,6-pentamethylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 22302926 |
| Molecular Formula | C23H24Cl2N4O2 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1-[(Z)-(2,3,4,5,6-pentamethylphenyl)methylideneamino]urea |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1N(/N=C\c1c(C)c(C)c(C)c(C)c1C)C(N)=O |
| InChI | InChI=1S/C23H24Cl2N4O2/c1-11-12(2)14(4)17(15(5)13(11)3)10-27-29(23(26)30)22-16(6)31-28-21(22)20-18(24)8-7-9-19(20)25/h7-10H,1-6H3,(H2,26,30)/b27-10- |
| InChIKey | YYROPSIMVFPSFU-NCAUGAEKSA-N |
| XLogP | 6.42 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|