C23H23Cl2N3O3 — CID 2804481
[(2,3,4,5,6-pentamethylphenyl)methylideneamino] N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 2804481) has the molecular formula C23H23Cl2N3O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is [(2,3,4,5,6-pentamethylphenyl)methylideneamino] N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | [(2,3,4,5,6-pentamethylphenyl)methylideneamino] N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 2804481 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | [(2,3,4,5,6-pentamethylphenyl)methylideneamino] N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1NC(=O)ON=Cc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C23H23Cl2N3O3/c1-11-12(2)14(4)17(15(5)13(11)3)10-26-31-23(29)27-21-16(6)30-28-22(21)20-18(24)8-7-9-19(20)25/h7-10H,1-6H3,(H,27,29) |
| InChIKey | KILSILVCHHUBBD-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|