C16H11Cl2N5O4S — CID 2743056
1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[(5-nitrothiophen-2-yl)methylideneamino]urea (PubChem CID 2743056) has the molecular formula C16H11Cl2N5O4S and a molecular weight of 440.27 g/mol. Its IUPAC name is 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[(5-nitrothiophen-2-yl)methylideneamino]urea.
| Compound Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[(5-nitrothiophen-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 2743056 |
| Molecular Formula | C16H11Cl2N5O4S |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 1-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[(5-nitrothiophen-2-yl)methylideneamino]urea |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1NC(=O)NN=Cc1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H11Cl2N5O4S/c1-8-14(15(22-27-8)13-10(17)3-2-4-11(13)18)20-16(24)21-19-7-9-5-6-12(28-9)23(25)26/h2-7H,1H3,(H2,20,21,24) |
| InChIKey | SXOPTJPEOLYNCD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|