C17H12Cl3FN4O2 — CID 2743061
1-(2-chloro-6-fluoroanilino)-3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea (PubChem CID 2743061) has the molecular formula C17H12Cl3FN4O2 and a molecular weight of 429.67 g/mol. Its IUPAC name is 1-(2-chloro-6-fluoroanilino)-3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea.
| Compound Name | 1-(2-chloro-6-fluoroanilino)-3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea |
|---|---|
| PubChem CID | 2743061 |
| Molecular Formula | C17H12Cl3FN4O2 |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 1-(2-chloro-6-fluoroanilino)-3-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1NC(=O)NNc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H12Cl3FN4O2/c1-8-14(16(25-27-8)13-9(18)4-2-5-10(13)19)22-17(26)24-23-15-11(20)6-3-7-12(15)21/h2-7,23H,1H3,(H2,22,24,26) |
| InChIKey | DMRUGHINYYFEOI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|