C24H18Cl4N2O4 — CID 165035091
3-(2,6-dichlorophenyl)-4-[(E)-2-methoxyethenyl]-5-methyl-1,2-oxazole;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbaldehyde (PubChem CID 165035091) has the molecular formula C24H18Cl4N2O4 and a molecular weight of 540.23 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-4-[(E)-2-methoxyethenyl]-5-methyl-1,2-oxazole;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbaldehyde.
| Compound Name | 3-(2,6-dichlorophenyl)-4-[(E)-2-methoxyethenyl]-5-methyl-1,2-oxazole;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 165035091 |
| Molecular Formula | C24H18Cl4N2O4 |
| Molecular Weight | 540.23 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-4-[(E)-2-methoxyethenyl]-5-methyl-1,2-oxazole;3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbaldehyde |
| SMILES | CO/C=C/c1c(-c2c(Cl)cccc2Cl)noc1C.Cc1onc(-c2c(Cl)cccc2Cl)c1C=O |
| InChI | InChI=1S/C13H11Cl2NO2.C11H7Cl2NO2/c1-8-9(6-7-17-2)13(16-18-8)12-10(14)4-3-5-11(12)15;1-6-7(5-15)11(14-16-6)10-8(12)3-2-4-9(10)13/h3-7H,1-2H3;2-5H,1H3/b7-6+; |
| InChIKey | NGJWEPBMZPGKSD-UHDJGPCESA-N |
| XLogP | 8.34 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.23 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|