C21H20Cl2N2O4 — CID 53432866
N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]formamide (PubChem CID 53432866) has the molecular formula C21H20Cl2N2O4 and a molecular weight of 435.31 g/mol. Its IUPAC name is N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]formamide.
| Compound Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]formamide |
|---|---|
| PubChem CID | 53432866 |
| Molecular Formula | C21H20Cl2N2O4 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[2-(3,4-dimethoxyphenyl)ethyl]formamide |
| SMILES | COc1ccc(CCN(C=O)c2c(-c3c(Cl)cccc3Cl)noc2C)cc1OC |
| InChI | InChI=1S/C21H20Cl2N2O4/c1-13-21(20(24-29-13)19-15(22)5-4-6-16(19)23)25(12-26)10-9-14-7-8-17(27-2)18(11-14)28-3/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | GKPLXSDKDUVPBR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|