C19H16Cl2N4O2S — CID 53432882
N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[methyl(phenylcarbamothioyl)amino]formamide (PubChem CID 53432882) has the molecular formula C19H16Cl2N4O2S and a molecular weight of 435.34 g/mol. Its IUPAC name is N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[methyl(phenylcarbamothioyl)amino]formamide.
| Compound Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[methyl(phenylcarbamothioyl)amino]formamide |
|---|---|
| PubChem CID | 53432882 |
| Molecular Formula | C19H16Cl2N4O2S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-N-[methyl(phenylcarbamothioyl)amino]formamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1N(C=O)N(C)C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H16Cl2N4O2S/c1-12-18(17(23-27-12)16-14(20)9-6-10-15(16)21)25(11-26)24(2)19(28)22-13-7-4-3-5-8-13/h3-11H,1-2H3,(H,22,28) |
| InChIKey | SLURXYJYKGWODP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|