C18H13F3N2O2S — CID 57367410
N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethylsulfanyl)phenyl]formamide (PubChem CID 57367410) has the molecular formula C18H13F3N2O2S and a molecular weight of 378.38 g/mol. Its IUPAC name is N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethylsulfanyl)phenyl]formamide.
| Compound Name | N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethylsulfanyl)phenyl]formamide |
|---|---|
| PubChem CID | 57367410 |
| Molecular Formula | C18H13F3N2O2S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-N-[4-(trifluoromethylsulfanyl)phenyl]formamide |
| SMILES | Cc1onc(-c2ccccc2)c1N(C=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13F3N2O2S/c1-12-17(16(22-25-12)13-5-3-2-4-6-13)23(11-24)14-7-9-15(10-8-14)26-18(19,20)21/h2-11H,1H3 |
| InChIKey | VSWQJBDVUNGNED-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|