About 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea
1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea (PubChem CID 138739382) has the molecular formula C11H12ClN5O2
and a molecular weight of 281.70 g/mol. Its IUPAC name is 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea.
Molecular Properties
| Compound Name | 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea |
| PubChem CID | 138739382 |
| Molecular Formula | C11H12ClN5O2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea |
| SMILES | Cc1onc(-c2ccccc2Cl)c1N(N)C(=O)NN |
| InChI | InChI=1S/C11H12ClN5O2/c1-6-10(17(14)11(18)15-13)9(16-19-6)7-4-2-3-5-8(7)12/h2-5H,13-14H2,1H3,(H,15,18) |
| InChIKey | REVKFZAFMLNMGQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea?
The IUPAC name of 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea (CID 138739382) is 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea.
What is the SMILES notation for 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea?
The canonical SMILES for 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea is Cc1onc(-c2ccccc2Cl)c1N(N)C(=O)NN.
What is the InChIKey of 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea?
The InChIKey is REVKFZAFMLNMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN5O2/c1-6-10(17(14)11(18)15-13)9(16-19-6)7-4-2-3-5-8(7)12/h2-5H,13-14H2,1H3,(H,15,18).
What are the key properties of 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea?
1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea has a molecular weight of 281.70 g/mol, XLogP of 1.57, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea is sourced from PubChem (CID 138739382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).