C11H12ClN5O2 — CID 138739382
1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea (PubChem CID 138739382) has the molecular formula C11H12ClN5O2 and a molecular weight of 281.70 g/mol. Its IUPAC name is 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea.
| Compound Name | 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea |
|---|---|
| PubChem CID | 138739382 |
| Molecular Formula | C11H12ClN5O2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1,3-diamino-1-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]urea |
| SMILES | Cc1onc(-c2ccccc2Cl)c1N(N)C(=O)NN |
| InChI | InChI=1S/C11H12ClN5O2/c1-6-10(17(14)11(18)15-13)9(16-19-6)7-4-2-3-5-8(7)12/h2-5H,13-14H2,1H3,(H,15,18) |
| InChIKey | REVKFZAFMLNMGQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|