C20H31N — CID 102431449
(4R)-4-[(4E)-1-isocyano-5,9-dimethyldeca-4,8-dienyl]-1-methylcyclohexene (PubChem CID 102431449) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is (4R)-4-[(4E)-1-isocyano-5,9-dimethyldeca-4,8-dienyl]-1-methylcyclohexene.
| Compound Name | (4R)-4-[(4E)-1-isocyano-5,9-dimethyldeca-4,8-dienyl]-1-methylcyclohexene |
|---|---|
| PubChem CID | 102431449 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (4R)-4-[(4E)-1-isocyano-5,9-dimethyldeca-4,8-dienyl]-1-methylcyclohexene |
| SMILES | [C-]#[N+]C(CC/C=C(\C)CCC=C(C)C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C20H31N/c1-16(2)8-6-9-17(3)10-7-11-20(21-5)19-14-12-18(4)13-15-19/h8,10,12,19-20H,6-7,9,11,13-15H2,1-4H3/b17-10+/t19-,20?/m0/s1 |
| InChIKey | HOTOOOFDUYAWJM-RQPQYBQYSA-N |
| XLogP | 6.49 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|