C19H22BrN3 — CID 102432702
N-(4-bromophenyl)-N'-(4-methylphenyl)piperidine-1-carboximidamide (PubChem CID 102432702) has the molecular formula C19H22BrN3 and a molecular weight of 372.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-(4-methylphenyl)piperidine-1-carboximidamide.
| Compound Name | N-(4-bromophenyl)-N'-(4-methylphenyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 102432702 |
| Molecular Formula | C19H22BrN3 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-(4-bromophenyl)-N'-(4-methylphenyl)piperidine-1-carboximidamide |
| SMILES | Cc1ccc(/N=C(/Nc2ccc(Br)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H22BrN3/c1-15-5-9-17(10-6-15)21-19(23-13-3-2-4-14-23)22-18-11-7-16(20)8-12-18/h5-12H,2-4,13-14H2,1H3,(H,21,22) |
| InChIKey | MSUMGJGJEZCJER-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|