C15H20O3 — CID 102433197
2,2-dimethyl-2'-methylidenespiro[4,7a-dihydro-3aH-1,3-benzodioxole-7,3'-cyclohexane]-1'-one (PubChem CID 102433197) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2,2-dimethyl-2'-methylidenespiro[4,7a-dihydro-3aH-1,3-benzodioxole-7,3'-cyclohexane]-1'-one.
| Compound Name | 2,2-dimethyl-2'-methylidenespiro[4,7a-dihydro-3aH-1,3-benzodioxole-7,3'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 102433197 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2,2-dimethyl-2'-methylidenespiro[4,7a-dihydro-3aH-1,3-benzodioxole-7,3'-cyclohexane]-1'-one |
| SMILES | C=C1C(=O)CCCC12C=CCC1OC(C)(C)OC12 |
| InChI | InChI=1S/C15H20O3/c1-10-11(16)6-4-8-15(10)9-5-7-12-13(15)18-14(2,3)17-12/h5,9,12-13H,1,4,6-8H2,2-3H3 |
| InChIKey | KXKZQTUWTOOXFE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|