C11H18O3 — CID 102432277
(3aR,8Z,9aS)-2,2,5-trimethyl-4,5,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-d]oxocine (PubChem CID 102432277) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3aR,8Z,9aS)-2,2,5-trimethyl-4,5,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-d]oxocine.
| Compound Name | (3aR,8Z,9aS)-2,2,5-trimethyl-4,5,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-d]oxocine |
|---|---|
| PubChem CID | 102432277 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3aR,8Z,9aS)-2,2,5-trimethyl-4,5,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-d]oxocine |
| SMILES | CC1C[C@H]2OC(C)(C)O[C@H]2/C=C\CO1 |
| InChI | InChI=1S/C11H18O3/c1-8-7-10-9(5-4-6-12-8)13-11(2,3)14-10/h4-5,8-10H,6-7H2,1-3H3/b5-4-/t8?,9-,10+/m0/s1 |
| InChIKey | MKLPTLSHXFRIJU-RISRVSJLSA-N |
| XLogP | 1.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|