C10H17Cl3 — CID 102433339
(Z)-1,1,3-trichlorodec-2-ene (PubChem CID 102433339) has the molecular formula C10H17Cl3 and a molecular weight of 243.60 g/mol. Its IUPAC name is (Z)-1,1,3-trichlorodec-2-ene.
| Compound Name | (Z)-1,1,3-trichlorodec-2-ene |
|---|---|
| PubChem CID | 102433339 |
| Molecular Formula | C10H17Cl3 |
| Molecular Weight | 243.60 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | (Z)-1,1,3-trichlorodec-2-ene |
| SMILES | CCCCCCC/C(Cl)=C/C(Cl)Cl |
| InChI | InChI=1S/C10H17Cl3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h8,10H,2-7H2,1H3/b9-8- |
| InChIKey | XBWKXDIZNDFFQU-HJWRWDBZSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|