C26H23NO4 — CID 102434104
ethyl (3R)-1-methyl-2-oxo-3-(2-oxo-1,2-diphenylethyl)indole-3-carboxylate (PubChem CID 102434104) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl (3R)-1-methyl-2-oxo-3-(2-oxo-1,2-diphenylethyl)indole-3-carboxylate.
| Compound Name | ethyl (3R)-1-methyl-2-oxo-3-(2-oxo-1,2-diphenylethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 102434104 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | ethyl (3R)-1-methyl-2-oxo-3-(2-oxo-1,2-diphenylethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(C(=O)c2ccccc2)c2ccccc2)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C26H23NO4/c1-3-31-25(30)26(20-16-10-11-17-21(20)27(2)24(26)29)22(18-12-6-4-7-13-18)23(28)19-14-8-5-9-15-19/h4-17,22H,3H2,1-2H3/t22?,26-/m0/s1 |
| InChIKey | JTEDSURZEBCJSI-XGCAABAXSA-N |
| XLogP | 4.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|