C13H13NO4 — CID 102223024
ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate (PubChem CID 102223024) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate.
| Compound Name | ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate |
|---|---|
| PubChem CID | 102223024 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C13H13NO4/c1-3-17-11(15)10-13(18-10)8-6-4-5-7-9(8)14(2)12(13)16/h4-7,10H,3H2,1-2H3/t10-,13+/m1/s1 |
| InChIKey | NEUJFQYUPZIXDX-MFKMUULPSA-N |
| XLogP | 0.82 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|