About ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate
ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate (PubChem CID 102223024) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate.
Molecular Properties
| Compound Name | ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate |
| PubChem CID | 102223024 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate |
| SMILES | CCOC(=O)[C@H]1O[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C13H13NO4/c1-3-17-11(15)10-13(18-10)8-6-4-5-7-9(8)14(2)12(13)16/h4-7,10H,3H2,1-2H3/t10-,13+/m1/s1 |
| InChIKey | NEUJFQYUPZIXDX-MFKMUULPSA-N |
| XLogP | 0.82 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate?
The IUPAC name of ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate (CID 102223024) is ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate.
What is the SMILES notation for ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate?
The canonical SMILES for ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate is CCOC(=O)[C@H]1O[C@]12C(=O)N(C)c1ccccc12.
What is the InChIKey of ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate?
The InChIKey is NEUJFQYUPZIXDX-MFKMUULPSA-N. The full InChI is InChI=1S/C13H13NO4/c1-3-17-11(15)10-13(18-10)8-6-4-5-7-9(8)14(2)12(13)16/h4-7,10H,3H2,1-2H3/t10-,13+/m1/s1.
What are the key properties of ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate?
ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate has a molecular weight of 247.25 g/mol, XLogP of 0.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2'S,3S)-1-methyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxylate is sourced from PubChem (CID 102223024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).