C25H29NO4 — CID 122706993
ethyl (1S,2R,3R,4S,5E)-5-(cyclohexylmethylidene)-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-indole]-2-carboxylate (PubChem CID 122706993) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4S,5E)-5-(cyclohexylmethylidene)-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-indole]-2-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4S,5E)-5-(cyclohexylmethylidene)-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-indole]-2-carboxylate |
|---|---|
| PubChem CID | 122706993 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | ethyl (1S,2R,3R,4S,5E)-5-(cyclohexylmethylidene)-1'-methyl-2',6-dioxospiro[bicyclo[2.2.1]heptane-3,3'-indole]-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@@H](/C(=C\C3CCCCC3)C2=O)[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C25H29NO4/c1-3-30-23(28)21-17-14-19(16(22(17)27)13-15-9-5-4-6-10-15)25(21)18-11-7-8-12-20(18)26(2)24(25)29/h7-8,11-13,15,17,19,21H,3-6,9-10,14H2,1-2H3/b16-13+/t17-,19-,21-,25+/m0/s1 |
| InChIKey | JYSUIAJTTLHQJG-KBERTMQSSA-N |
| XLogP | 3.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|