C19H14N2O4 — CID 10496920
ethyl 12-oxospiro[indolo[2,1-b]quinazoline-6,3'-oxirane]-2'-carboxylate (PubChem CID 10496920) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is ethyl 12-oxospiro[indolo[2,1-b]quinazoline-6,3'-oxirane]-2'-carboxylate.
| Compound Name | ethyl 12-oxospiro[indolo[2,1-b]quinazoline-6,3'-oxirane]-2'-carboxylate |
|---|---|
| PubChem CID | 10496920 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 12-oxospiro[indolo[2,1-b]quinazoline-6,3'-oxirane]-2'-carboxylate |
| SMILES | CCOC(=O)C1OC12c1ccccc1-n1c2nc2ccccc2c1=O |
| InChI | InChI=1S/C19H14N2O4/c1-2-24-17(23)15-19(25-15)12-8-4-6-10-14(12)21-16(22)11-7-3-5-9-13(11)20-18(19)21/h3-10,15H,2H2,1H3 |
| InChIKey | DBGFOLKXZBFNPW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|