C28H25N3O2S — CID 5036673
2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-3-phenylquinazolin-4-one (PubChem CID 5036673) has the molecular formula C28H25N3O2S and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 5036673 |
| Molecular Formula | C28H25N3O2S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanyl-3-phenylquinazolin-4-one |
| SMILES | CN1C(=CC(=O)CSc2nc3ccccc3c(=O)n2-c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C28H25N3O2S/c1-28(2)22-14-8-10-16-24(22)30(3)25(28)17-20(32)18-34-27-29-23-15-9-7-13-21(23)26(33)31(27)19-11-5-4-6-12-19/h4-17H,18H2,1-3H3 |
| InChIKey | VBJNHHLDGOKVEL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|