C30H29N3O2S — CID 3578396
3-[(4-methylphenyl)methyl]-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylquinazolin-4-one (PubChem CID 3578396) has the molecular formula C30H29N3O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylquinazolin-4-one.
| Compound Name | 3-[(4-methylphenyl)methyl]-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 3578396 |
| Molecular Formula | C30H29N3O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-2-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]sulfanylquinazolin-4-one |
| SMILES | Cc1ccc(Cn2c(SCC(=O)C=C3N(C)c4ccccc4C3(C)C)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C30H29N3O2S/c1-20-13-15-21(16-14-20)18-33-28(35)23-9-5-7-11-25(23)31-29(33)36-19-22(34)17-27-30(2,3)24-10-6-8-12-26(24)32(27)4/h5-17H,18-19H2,1-4H3 |
| InChIKey | HETAJBMRFLFUQF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|