C12H21NO4 — CID 10243500
(1R,2R,6S,9R,12R)-12-methoxy-4,4-dimethyl-3,5,13-trioxa-8-azatricyclo[7.4.0.02,6]tridecane (PubChem CID 10243500) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is (1R,2R,6S,9R,12R)-12-methoxy-4,4-dimethyl-3,5,13-trioxa-8-azatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2R,6S,9R,12R)-12-methoxy-4,4-dimethyl-3,5,13-trioxa-8-azatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 10243500 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (1R,2R,6S,9R,12R)-12-methoxy-4,4-dimethyl-3,5,13-trioxa-8-azatricyclo[7.4.0.02,6]tridecane |
| SMILES | CO[C@H]1CC[C@H]2NC[C@@H]3OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C12H21NO4/c1-12(2)16-8-6-13-7-4-5-9(14-3)15-10(7)11(8)17-12/h7-11,13H,4-6H2,1-3H3/t7-,8+,9-,10-,11-/m1/s1 |
| InChIKey | CPVORSOMYKDWGJ-RCZSTQMZSA-N |
| XLogP | 0.63 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |