C11H19NO4 — CID 71604951
(E)-3-[(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-methoxyprop-2-en-1-ol (PubChem CID 71604951) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (E)-3-[(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-methoxyprop-2-en-1-ol.
| Compound Name | (E)-3-[(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-methoxyprop-2-en-1-ol |
|---|---|
| PubChem CID | 71604951 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (E)-3-[(3aR,4S,6aS)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-4-yl]-3-methoxyprop-2-en-1-ol |
| SMILES | CO/C(=C/CO)[C@H]1NC[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C11H19NO4/c1-11(2)15-8-6-12-9(10(8)16-11)7(14-3)4-5-13/h4,8-10,12-13H,5-6H2,1-3H3/b7-4+/t8-,9+,10-/m0/s1 |
| InChIKey | DHEMVZCEWHSPKL-ZSJMHTLASA-N |
| XLogP | 0.00 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|