C14H27NO3 — CID 122657809
[(3aR,6R,7R,7aR)-2,2-dimethyl-6-pentyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl]methanol (PubChem CID 122657809) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is [(3aR,6R,7R,7aR)-2,2-dimethyl-6-pentyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl]methanol.
| Compound Name | [(3aR,6R,7R,7aR)-2,2-dimethyl-6-pentyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 122657809 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | [(3aR,6R,7R,7aR)-2,2-dimethyl-6-pentyl-3a,4,5,6,7,7a-hexahydro-[1,3]dioxolo[4,5-c]pyridin-7-yl]methanol |
| SMILES | CCCCC[C@H]1NC[C@H]2OC(C)(C)O[C@@H]2[C@H]1CO |
| InChI | InChI=1S/C14H27NO3/c1-4-5-6-7-11-10(9-16)13-12(8-15-11)17-14(2,3)18-13/h10-13,15-16H,4-9H2,1-3H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | OAUHZVYGUXEEPG-UMSGYPCISA-N |
| XLogP | 1.67 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|