C19H29NO4S — CID 102433186
(3aS,6aR)-4-[1-(benzenesulfonyl)hexyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 102433186) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is (3aS,6aR)-4-[1-(benzenesulfonyl)hexyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aS,6aR)-4-[1-(benzenesulfonyl)hexyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 102433186 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3aS,6aR)-4-[1-(benzenesulfonyl)hexyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CCCCCC(C1NC[C@H]2OC(C)(C)O[C@@H]12)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H29NO4S/c1-4-5-7-12-16(25(21,22)14-10-8-6-9-11-14)17-18-15(13-20-17)23-19(2,3)24-18/h6,8-11,15-18,20H,4-5,7,12-13H2,1-3H3/t15-,16?,17?,18-/m1/s1 |
| InChIKey | FKHOOHFFWJIWTO-AQEOSJORSA-N |
| XLogP | 2.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|