C30H49ClN2O9S — CID 11614391
[1-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(benzenesulfonyl)carbamate;hydrochloride (PubChem CID 11614391) has the molecular formula C30H49ClN2O9S and a molecular weight of 649.25 g/mol. Its IUPAC name is [1-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(benzenesulfonyl)carbamate;hydrochloride.
| Compound Name | [1-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(benzenesulfonyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 11614391 |
| Molecular Formula | C30H49ClN2O9S |
| Molecular Weight | 649.25 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | [1-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-morpholin-4-ylethyl] N-(benzenesulfonyl)carbamate;hydrochloride |
| SMILES | CCCCCCCCCCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(CN1CCOCC1)OC(=O)NS(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C30H48N2O9S.ClH/c1-4-5-6-7-8-9-10-14-19-37-26-25(39-28-27(26)40-30(2,3)41-28)24(22-32-17-20-36-21-18-32)38-29(33)31-42(34,35)23-15-12-11-13-16-23;/h11-13,15-16,24-28H,4-10,14,17-22H2,1-3H3,(H,31,33);1H/t24?,25-,26+,27-,28-;/m1./s1 |
| InChIKey | JUQHARAJAFGKOX-MGIGSSQDSA-N |
| XLogP | 4.63 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|