C30H48N2O8S — CID 11671810
[1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(azepan-1-yl)ethyl] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 11671810) has the molecular formula C30H48N2O8S and a molecular weight of 596.79 g/mol. Its IUPAC name is [1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(azepan-1-yl)ethyl] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(azepan-1-yl)ethyl] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 11671810 |
| Molecular Formula | C30H48N2O8S |
| Molecular Weight | 596.79 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | [1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(azepan-1-yl)ethyl] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | CCCCCCCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(CN1CCCCCC1)OC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H48N2O8S/c1-5-6-7-10-13-20-36-26-25(38-28-27(26)39-30(3,4)40-28)24(21-32-18-11-8-9-12-19-32)37-29(33)31-41(34,35)23-16-14-22(2)15-17-23/h14-17,24-28H,5-13,18-21H2,1-4H3,(H,31,33)/t24?,25-,26+,27-,28-/m1/s1 |
| InChIKey | ZXFJBKPSOBCKPM-QWJUJVJMSA-N |
| XLogP | 4.89 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|