About (3-methoxyphenyl) N-pyridin-2-ylcarbamate
(3-methoxyphenyl) N-pyridin-2-ylcarbamate (PubChem CID 102435207) has the molecular formula C13H12N2O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is (3-methoxyphenyl) N-pyridin-2-ylcarbamate.
Molecular Properties
| Compound Name | (3-methoxyphenyl) N-pyridin-2-ylcarbamate |
| PubChem CID | 102435207 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (3-methoxyphenyl) N-pyridin-2-ylcarbamate |
| SMILES | COc1cccc(OC(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C13H12N2O3/c1-17-10-5-4-6-11(9-10)18-13(16)15-12-7-2-3-8-14-12/h2-9H,1H3,(H,14,15,16) |
| InChIKey | QZTJDHNZYPXZHJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methoxyphenyl) N-pyridin-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl) N-pyridin-2-ylcarbamate?
The IUPAC name of (3-methoxyphenyl) N-pyridin-2-ylcarbamate (CID 102435207) is (3-methoxyphenyl) N-pyridin-2-ylcarbamate.
What is the SMILES notation for (3-methoxyphenyl) N-pyridin-2-ylcarbamate?
The canonical SMILES for (3-methoxyphenyl) N-pyridin-2-ylcarbamate is COc1cccc(OC(=O)Nc2ccccn2)c1.
What is the InChIKey of (3-methoxyphenyl) N-pyridin-2-ylcarbamate?
The InChIKey is QZTJDHNZYPXZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c1-17-10-5-4-6-11(9-10)18-13(16)15-12-7-2-3-8-14-12/h2-9H,1H3,(H,14,15,16).
What are the key properties of (3-methoxyphenyl) N-pyridin-2-ylcarbamate?
(3-methoxyphenyl) N-pyridin-2-ylcarbamate has a molecular weight of 244.25 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl) N-pyridin-2-ylcarbamate is sourced from PubChem (CID 102435207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).