C12H11N3O3 — CID 66833981
phenyl N-(6-methoxypyrimidin-4-yl)carbamate (PubChem CID 66833981) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is phenyl N-(6-methoxypyrimidin-4-yl)carbamate.
| Compound Name | phenyl N-(6-methoxypyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 66833981 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | phenyl N-(6-methoxypyrimidin-4-yl)carbamate |
| SMILES | COc1cc(NC(=O)Oc2ccccc2)ncn1 |
| InChI | InChI=1S/C12H11N3O3/c1-17-11-7-10(13-8-14-11)15-12(16)18-9-5-3-2-4-6-9/h2-8H,1H3,(H,13,14,15,16) |
| InChIKey | LFCCUPFKPWNQOE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |