C41H40O10 — CID 102435653
9,19,24,26,28,32-hexamethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(26),3(35),5,8,10,13(31),15,18,20,23(27),24,28-dodecaene-4,14,30,34-tetrone (PubChem CID 102435653) has the molecular formula C41H40O10 and a molecular weight of 692.76 g/mol. Its IUPAC name is 9,19,24,26,28,32-hexamethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(26),3(35),5,8,10,13(31),15,18,20,23(27),24,28-dodecaene-4,14,30,34-tetrone.
| Compound Name | 9,19,24,26,28,32-hexamethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(26),3(35),5,8,10,13(31),15,18,20,23(27),24,28-dodecaene-4,14,30,34-tetrone |
|---|---|
| PubChem CID | 102435653 |
| Molecular Formula | C41H40O10 |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 9,19,24,26,28,32-hexamethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(26),3(35),5,8,10,13(31),15,18,20,23(27),24,28-dodecaene-4,14,30,34-tetrone |
| SMILES | COC1=C2CC3=CC(=O)C(=CC3=O)Cc3cc(OC)c(cc3OC)Cc3cc(OC)c(cc3OC)CC3=CC(=O)C(=CC3=O)CC(=C1)C(OC)C2 |
| InChI | InChI=1S/C41H40O10/c1-46-36-16-27-8-23-13-35(45)25(15-33(23)43)10-29-19-41(51-6)31(21-39(29)49-4)11-30-20-38(48-3)28(18-40(30)50-5)9-24-14-32(42)22(12-34(24)44)7-26(36)17-37(27)47-2/h12-16,18-21,37H,7-11,17H2,1-6H3 |
| InChIKey | CMRCDLLJNBPIEB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|