C15H32O2 — CID 102436924
(5S,6S,7R,8R)-5,7-dimethyltridecane-6,8-diol (PubChem CID 102436924) has the molecular formula C15H32O2 and a molecular weight of 244.42 g/mol. Its IUPAC name is (5S,6S,7R,8R)-5,7-dimethyltridecane-6,8-diol.
| Compound Name | (5S,6S,7R,8R)-5,7-dimethyltridecane-6,8-diol |
|---|---|
| PubChem CID | 102436924 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | (5S,6S,7R,8R)-5,7-dimethyltridecane-6,8-diol |
| SMILES | CCCCC[C@@H](O)[C@@H](C)[C@@H](O)[C@@H](C)CCCC |
| InChI | InChI=1S/C15H32O2/c1-5-7-9-11-14(16)13(4)15(17)12(3)10-8-6-2/h12-17H,5-11H2,1-4H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | PSPSSBOYDRWNHZ-YJNKXOJESA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|