C15H32OS — CID 173156608
(4S)-2,3,5-trimethyl-1-sulfanyldodecan-4-ol (PubChem CID 173156608) has the molecular formula C15H32OS and a molecular weight of 260.49 g/mol. Its IUPAC name is (4S)-2,3,5-trimethyl-1-sulfanyldodecan-4-ol.
| Compound Name | (4S)-2,3,5-trimethyl-1-sulfanyldodecan-4-ol |
|---|---|
| PubChem CID | 173156608 |
| Molecular Formula | C15H32OS |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | (4S)-2,3,5-trimethyl-1-sulfanyldodecan-4-ol |
| SMILES | CCCCCCCC(C)[C@H](O)C(C)C(C)CS |
| InChI | InChI=1S/C15H32OS/c1-5-6-7-8-9-10-12(2)15(16)14(4)13(3)11-17/h12-17H,5-11H2,1-4H3/t12?,13?,14?,15-/m0/s1 |
| InChIKey | FRCZDAQFAHRTAQ-BOADVZGGSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|