C38H46N2O8 — CID 102437326
bis[(1R,5S)-2-methoxycarbonyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate (PubChem CID 102437326) has the molecular formula C38H46N2O8 and a molecular weight of 658.79 g/mol. Its IUPAC name is bis[(1R,5S)-2-methoxycarbonyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate.
| Compound Name | bis[(1R,5S)-2-methoxycarbonyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 102437326 |
| Molecular Formula | C38H46N2O8 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | bis[(1R,5S)-2-methoxycarbonyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate |
| SMILES | COC(=O)C1C(OC(=O)C2C(c3ccccc3)C(C(=O)OC3C[C@@H]4CC[C@H](C3C(=O)OC)N4C)C2c2ccccc2)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C38H46N2O8/c1-39-23-15-17-25(39)31(35(41)45-3)27(19-23)47-37(43)33-29(21-11-7-5-8-12-21)34(30(33)22-13-9-6-10-14-22)38(44)48-28-20-24-16-18-26(40(24)2)32(28)36(42)46-4/h5-14,23-34H,15-20H2,1-4H3/t23-,24-,25+,26+,27?,28?,29?,30?,31?,32?,33?,34?/m0/s1 |
| InChIKey | BUOSLGZEBFSUDD-SDFURHTHSA-N |
| XLogP | 3.93 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|