C17H19NO6S — CID 102437802
10-O-tert-butyl 8-O,9-O-dimethyl 3-thia-10-azatricyclo[5.2.1.02,6]deca-2(6),4,8-triene-8,9,10-tricarboxylate (PubChem CID 102437802) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is 10-O-tert-butyl 8-O,9-O-dimethyl 3-thia-10-azatricyclo[5.2.1.02,6]deca-2(6),4,8-triene-8,9,10-tricarboxylate.
| Compound Name | 10-O-tert-butyl 8-O,9-O-dimethyl 3-thia-10-azatricyclo[5.2.1.02,6]deca-2(6),4,8-triene-8,9,10-tricarboxylate |
|---|---|
| PubChem CID | 102437802 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 10-O-tert-butyl 8-O,9-O-dimethyl 3-thia-10-azatricyclo[5.2.1.02,6]deca-2(6),4,8-triene-8,9,10-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2c3sccc3C1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H19NO6S/c1-17(2,3)24-16(21)18-11-8-6-7-25-13(8)12(18)10(15(20)23-5)9(11)14(19)22-4/h6-7,11-12H,1-5H3 |
| InChIKey | ADMPMYAFHFKOFY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|