C21H21NO6S — CID 101230948
14-O-tert-butyl 12-O,13-O-dimethyl 9-thia-14-azatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),3,5,7,12-pentaene-12,13,14-tricarboxylate (PubChem CID 101230948) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is 14-O-tert-butyl 12-O,13-O-dimethyl 9-thia-14-azatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),3,5,7,12-pentaene-12,13,14-tricarboxylate.
| Compound Name | 14-O-tert-butyl 12-O,13-O-dimethyl 9-thia-14-azatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),3,5,7,12-pentaene-12,13,14-tricarboxylate |
|---|---|
| PubChem CID | 101230948 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 14-O-tert-butyl 12-O,13-O-dimethyl 9-thia-14-azatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),3,5,7,12-pentaene-12,13,14-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2c3c(sc4ccccc34)C1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H21NO6S/c1-21(2,3)28-20(25)22-15-12-10-8-6-7-9-11(10)29-17(12)16(22)14(19(24)27-5)13(15)18(23)26-4/h6-9,15-16H,1-5H3 |
| InChIKey | OTLUALNAUJRLHA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|