C34H36N2O4 — CID 154636798
tert-butyl 2-[10-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2H-pyridin-2-yl]anthracen-9-yl]-2H-pyridine-1-carboxylate (PubChem CID 154636798) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is tert-butyl 2-[10-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2H-pyridin-2-yl]anthracen-9-yl]-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 2-[10-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2H-pyridin-2-yl]anthracen-9-yl]-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 154636798 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | tert-butyl 2-[10-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2H-pyridin-2-yl]anthracen-9-yl]-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC=CC1c1c2ccccc2c(C2C=CC=CN2C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C34H36N2O4/c1-33(2,3)39-31(37)35-21-13-11-19-27(35)29-23-15-7-9-17-25(23)30(26-18-10-8-16-24(26)29)28-20-12-14-22-36(28)32(38)40-34(4,5)6/h7-22,27-28H,1-6H3 |
| InChIKey | KEWJQFCCPBPRSK-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|