C27H39NO4Si4 — CID 134865800
tert-butyl 5,5,7,7,15,15,17,17-octamethyl-6,16-dioxa-21-aza-5,7,15,17-tetrasilahexacyclo[9.9.1.02,10.04,8.012,20.014,18]henicosa-2,4(8),9,12,14(18),19-hexaene-21-carboxylate (PubChem CID 134865800) has the molecular formula C27H39NO4Si4 and a molecular weight of 553.96 g/mol. Its IUPAC name is tert-butyl 5,5,7,7,15,15,17,17-octamethyl-6,16-dioxa-21-aza-5,7,15,17-tetrasilahexacyclo[9.9.1.02,10.04,8.012,20.014,18]henicosa-2,4(8),9,12,14(18),19-hexaene-21-carboxylate.
| Compound Name | tert-butyl 5,5,7,7,15,15,17,17-octamethyl-6,16-dioxa-21-aza-5,7,15,17-tetrasilahexacyclo[9.9.1.02,10.04,8.012,20.014,18]henicosa-2,4(8),9,12,14(18),19-hexaene-21-carboxylate |
|---|---|
| PubChem CID | 134865800 |
| Molecular Formula | C27H39NO4Si4 |
| Molecular Weight | 553.96 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | tert-butyl 5,5,7,7,15,15,17,17-octamethyl-6,16-dioxa-21-aza-5,7,15,17-tetrasilahexacyclo[9.9.1.02,10.04,8.012,20.014,18]henicosa-2,4(8),9,12,14(18),19-hexaene-21-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2c3cc4c(cc3C1c1cc3c(cc12)[Si](C)(C)O[Si]3(C)C)[Si](C)(C)O[Si]4(C)C |
| InChI | InChI=1S/C27H39NO4Si4/c1-27(2,3)30-26(29)28-24-16-12-20-21(34(6,7)31-33(20,4)5)13-17(16)25(28)19-15-23-22(14-18(19)24)35(8,9)32-36(23,10)11/h12-15,24-25H,1-11H3 |
| InChIKey | VZFSMDZHSNWLQA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.96 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|