C20H34N2O12 — CID 101352218
ditert-butyl (1S,3R,4R,6S,7S,9R,10R,12S)-4,5,6,10,11,12-hexahydroxy-2,8-dioxa-13,14-diazatricyclo[7.3.1.13,7]tetradecane-13,14-dicarboxylate (PubChem CID 101352218) has the molecular formula C20H34N2O12 and a molecular weight of 494.49 g/mol. Its IUPAC name is ditert-butyl (1S,3R,4R,6S,7S,9R,10R,12S)-4,5,6,10,11,12-hexahydroxy-2,8-dioxa-13,14-diazatricyclo[7.3.1.13,7]tetradecane-13,14-dicarboxylate.
| Compound Name | ditert-butyl (1S,3R,4R,6S,7S,9R,10R,12S)-4,5,6,10,11,12-hexahydroxy-2,8-dioxa-13,14-diazatricyclo[7.3.1.13,7]tetradecane-13,14-dicarboxylate |
|---|---|
| PubChem CID | 101352218 |
| Molecular Formula | C20H34N2O12 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | ditert-butyl (1S,3R,4R,6S,7S,9R,10R,12S)-4,5,6,10,11,12-hexahydroxy-2,8-dioxa-13,14-diazatricyclo[7.3.1.13,7]tetradecane-13,14-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2O[C@H]3[C@@H](O)C(O)[C@@H](O)[C@@H](O[C@H]1[C@@H](O)C(O)[C@H]2O)N3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34N2O12/c1-19(2,3)33-17(29)21-13-9(25)7(23)10(26)14(21)32-16-12(28)8(24)11(27)15(31-13)22(16)18(30)34-20(4,5)6/h7-16,23-28H,1-6H3/t7?,8?,9-,10+,11+,12-,13-,14+,15+,16- |
| InChIKey | HQUACXPLSLLOAN-RSOUXGMESA-N |
| XLogP | -2.00 |
| TPSA | 198.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |