C21H33NO6 — CID 139050060
tritert-butyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate (PubChem CID 139050060) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is tritert-butyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate.
| Compound Name | tritert-butyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
|---|---|
| PubChem CID | 139050060 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | tritert-butyl (1S,2S,3S,4S,6S,7S)-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@@H]2[C@H]3[C@H](C(=O)OC(C)(C)C)[C@H]3N(C(=O)OC(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C21H33NO6/c1-19(2,3)26-16(23)12-10-11-13(17(24)27-20(4,5)6)15(11)22(14(10)12)18(25)28-21(7,8)9/h10-15H,1-9H3/t10-,11-,12-,13-,14-,15-/m0/s1 |
| InChIKey | DAURBTOQOPAGGK-LZXPERKUSA-N |
| XLogP | 3.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|