C12H16BrNO5 — CID 129354282
2-O-tert-butyl 6-O-methyl (1S,4R,5S,6R)-4-bromo-3-oxo-2-azabicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 129354282) has the molecular formula C12H16BrNO5 and a molecular weight of 334.17 g/mol. Its IUPAC name is 2-O-tert-butyl 6-O-methyl (1S,4R,5S,6R)-4-bromo-3-oxo-2-azabicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | 2-O-tert-butyl 6-O-methyl (1S,4R,5S,6R)-4-bromo-3-oxo-2-azabicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 129354282 |
| Molecular Formula | C12H16BrNO5 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2-O-tert-butyl 6-O-methyl (1S,4R,5S,6R)-4-bromo-3-oxo-2-azabicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@H]1N(C(=O)OC(C)(C)C)C(=O)[C@@H]2Br |
| InChI | InChI=1S/C12H16BrNO5/c1-12(2,3)19-11(17)14-8-5(7(13)9(14)15)6(8)10(16)18-4/h5-8H,1-4H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | IDBRBQSVIDEUTJ-WCTZXXKLSA-N |
| XLogP | 1.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|