C18H20N2O4S2 — CID 102441508
(2R,3R)-2-methyl-1-(2-nitrophenyl)sulfonyl-3-phenylsulfanylpiperidine (PubChem CID 102441508) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2R,3R)-2-methyl-1-(2-nitrophenyl)sulfonyl-3-phenylsulfanylpiperidine.
| Compound Name | (2R,3R)-2-methyl-1-(2-nitrophenyl)sulfonyl-3-phenylsulfanylpiperidine |
|---|---|
| PubChem CID | 102441508 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (2R,3R)-2-methyl-1-(2-nitrophenyl)sulfonyl-3-phenylsulfanylpiperidine |
| SMILES | C[C@@H]1[C@H](Sc2ccccc2)CCCN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O4S2/c1-14-17(25-15-8-3-2-4-9-15)11-7-13-19(14)26(23,24)18-12-6-5-10-16(18)20(21)22/h2-6,8-10,12,14,17H,7,11,13H2,1H3/t14-,17-/m1/s1 |
| InChIKey | ICRJQBADGUOBDH-RHSMWYFYSA-N |
| XLogP | 3.93 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|