C16H19N3O5S — CID 92877930
5-ethyl-3-methyl-4-[(2S)-1-(2-nitrophenyl)sulfonylpyrrolidin-2-yl]-1,2-oxazole (PubChem CID 92877930) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-ethyl-3-methyl-4-[(2S)-1-(2-nitrophenyl)sulfonylpyrrolidin-2-yl]-1,2-oxazole.
| Compound Name | 5-ethyl-3-methyl-4-[(2S)-1-(2-nitrophenyl)sulfonylpyrrolidin-2-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 92877930 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 5-ethyl-3-methyl-4-[(2S)-1-(2-nitrophenyl)sulfonylpyrrolidin-2-yl]-1,2-oxazole |
| SMILES | CCc1onc(C)c1[C@@H]1CCCN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O5S/c1-3-14-16(11(2)17-24-14)13-8-6-10-18(13)25(22,23)15-9-5-4-7-12(15)19(20)21/h4-5,7,9,13H,3,6,8,10H2,1-2H3/t13-/m0/s1 |
| InChIKey | HVYRJNWHWJBWPB-ZDUSSCGKSA-N |
| XLogP | 2.98 |
| TPSA | 106.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|